C23H17FN6O3 — CID 136917200
(4S)-4-(1,3-benzodioxol-5-yl)-1-[5-(4-fluorophenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136917200) has the molecular formula C23H17FN6O3 and a molecular weight of 444.43 g/mol. Its IUPAC name is (4S)-4-(1,3-benzodioxol-5-yl)-1-[5-(4-fluorophenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-4-(1,3-benzodioxol-5-yl)-1-[5-(4-fluorophenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136917200 |
| Molecular Formula | C23H17FN6O3 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (4S)-4-(1,3-benzodioxol-5-yl)-1-[5-(4-fluorophenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1nn(-c2nncc(-c3ccc(F)cc3)n2)c2c1[C@H](c1ccc3c(c1)OCO3)CC(=O)N2 |
| InChI | InChI=1S/C23H17FN6O3/c1-12-21-16(14-4-7-18-19(8-14)33-11-32-18)9-20(31)27-22(21)30(29-12)23-26-17(10-25-28-23)13-2-5-15(24)6-3-13/h2-8,10,16H,9,11H2,1H3,(H,27,31)/t16-/m0/s1 |
| InChIKey | GWTPAXJSCKDABX-INIZCTEOSA-N |
| XLogP | 3.37 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |