C24H21FN6O — CID 136917150
(4S)-4-(2,5-dimethylphenyl)-1-[5-(4-fluorophenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136917150) has the molecular formula C24H21FN6O and a molecular weight of 428.47 g/mol. Its IUPAC name is (4S)-4-(2,5-dimethylphenyl)-1-[5-(4-fluorophenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-4-(2,5-dimethylphenyl)-1-[5-(4-fluorophenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136917150 |
| Molecular Formula | C24H21FN6O |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (4S)-4-(2,5-dimethylphenyl)-1-[5-(4-fluorophenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1ccc(C)c([C@@H]2CC(=O)Nc3c2c(C)nn3-c2nncc(-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C24H21FN6O/c1-13-4-5-14(2)18(10-13)19-11-21(32)28-23-22(19)15(3)30-31(23)24-27-20(12-26-29-24)16-6-8-17(25)9-7-16/h4-10,12,19H,11H2,1-3H3,(H,28,32)/t19-/m0/s1 |
| InChIKey | OAWRXCAQIMXKCD-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |