C23H18F2N6O2 — CID 136916827
(4R)-4-(2,5-difluorophenyl)-1-[5-(4-methoxyphenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136916827) has the molecular formula C23H18F2N6O2 and a molecular weight of 448.43 g/mol. Its IUPAC name is (4R)-4-(2,5-difluorophenyl)-1-[5-(4-methoxyphenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4R)-4-(2,5-difluorophenyl)-1-[5-(4-methoxyphenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136916827 |
| Molecular Formula | C23H18F2N6O2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (4R)-4-(2,5-difluorophenyl)-1-[5-(4-methoxyphenyl)-1,2,4-triazin-3-yl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | COc1ccc(-c2cnnc(-n3nc(C)c4c3NC(=O)C[C@H]4c3cc(F)ccc3F)n2)cc1 |
| InChI | InChI=1S/C23H18F2N6O2/c1-12-21-17(16-9-14(24)5-8-18(16)25)10-20(32)28-22(21)31(30-12)23-27-19(11-26-29-23)13-3-6-15(33-2)7-4-13/h3-9,11,17H,10H2,1-2H3,(H,28,32)/t17-/m0/s1 |
| InChIKey | DSIYFTZZNHBSTO-KRWDZBQOSA-N |
| XLogP | 3.79 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |