C23H18F2N6O — CID 136916726
(4S)-4-(2,5-difluorophenyl)-3-methyl-1-[5-(4-methylphenyl)-1,2,4-triazin-3-yl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 136916726) has the molecular formula C23H18F2N6O and a molecular weight of 432.43 g/mol. Its IUPAC name is (4S)-4-(2,5-difluorophenyl)-3-methyl-1-[5-(4-methylphenyl)-1,2,4-triazin-3-yl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | (4S)-4-(2,5-difluorophenyl)-3-methyl-1-[5-(4-methylphenyl)-1,2,4-triazin-3-yl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 136916726 |
| Molecular Formula | C23H18F2N6O |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (4S)-4-(2,5-difluorophenyl)-3-methyl-1-[5-(4-methylphenyl)-1,2,4-triazin-3-yl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1ccc(-c2cnnc(-n3nc(C)c4c3NC(=O)C[C@@H]4c3cc(F)ccc3F)n2)cc1 |
| InChI | InChI=1S/C23H18F2N6O/c1-12-3-5-14(6-4-12)19-11-26-29-23(27-19)31-22-21(13(2)30-31)17(10-20(32)28-22)16-9-15(24)7-8-18(16)25/h3-9,11,17H,10H2,1-2H3,(H,28,32)/t17-/m1/s1 |
| InChIKey | JVVMSZINZCKKND-QGZVFWFLSA-N |
| XLogP | 4.09 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |