C23H24ClN5O4 — CID 136919445
5-[[(5R,7S)-7-(4-chlorophenyl)-5-(4-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]amino]-5-oxopentanoic acid (PubChem CID 136919445) has the molecular formula C23H24ClN5O4 and a molecular weight of 469.93 g/mol. Its IUPAC name is 5-[[(5R,7S)-7-(4-chlorophenyl)-5-(4-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(5R,7S)-7-(4-chlorophenyl)-5-(4-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 136919445 |
| Molecular Formula | C23H24ClN5O4 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 5-[[(5R,7S)-7-(4-chlorophenyl)-5-(4-methoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]amino]-5-oxopentanoic acid |
| SMILES | COc1ccc([C@H]2C[C@@H](c3ccc(Cl)cc3)n3nc(NC(=O)CCCC(=O)O)nc3N2)cc1 |
| InChI | InChI=1S/C23H24ClN5O4/c1-33-17-11-7-14(8-12-17)18-13-19(15-5-9-16(24)10-6-15)29-23(25-18)27-22(28-29)26-20(30)3-2-4-21(31)32/h5-12,18-19H,2-4,13H2,1H3,(H,31,32)(H2,25,26,27,28,30)/t18-,19+/m1/s1 |
| InChIKey | ZLOHVJMGDNZBLM-MOPGFXCFSA-N |
| XLogP | 4.28 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |