C22H20ClFN5O3- — CID 2012908
5-[[(5R,7S)-5-(4-chlorophenyl)-7-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]amino]-5-oxopentanoate (PubChem CID 2012908) has the molecular formula C22H20ClFN5O3- and a molecular weight of 456.89 g/mol. Its IUPAC name is 5-[[(5R,7S)-5-(4-chlorophenyl)-7-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]amino]-5-oxopentanoate.
| Compound Name | 5-[[(5R,7S)-5-(4-chlorophenyl)-7-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 2012908 |
| Molecular Formula | C22H20ClFN5O3- |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 5-[[(5R,7S)-5-(4-chlorophenyl)-7-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]amino]-5-oxopentanoate |
| SMILES | O=C([O-])CCCC(=O)Nc1nc2n(n1)[C@H](c1ccc(F)cc1)C[C@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C22H21ClFN5O3/c23-15-8-4-13(5-9-15)17-12-18(14-6-10-16(24)11-7-14)29-22(25-17)27-21(28-29)26-19(30)2-1-3-20(31)32/h4-11,17-18H,1-3,12H2,(H,31,32)(H2,25,26,27,28,30)/p-1/t17-,18+/m1/s1 |
| InChIKey | XLRLFIUCEYIOFK-MSOLQXFVSA-M |
| XLogP | 3.08 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |