C12H12N4 — CID 136921508
2-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-amine (PubChem CID 136921508) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 2-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-amine.
| Compound Name | 2-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-amine |
|---|---|
| PubChem CID | 136921508 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-phenyl-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-amine |
| SMILES | NC1=CNc2cc(-c3ccccc3)nn2C1 |
| InChI | InChI=1S/C12H12N4/c13-10-7-14-12-6-11(15-16(12)8-10)9-4-2-1-3-5-9/h1-7,14H,8,13H2 |
| InChIKey | LWQPGMVAGLUOHX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |