C10H13ClN4 — CID 136921557
6-chloro-1-cyclopentyl-4,7-dihydropyrazolo[5,4-d]pyrimidine (PubChem CID 136921557) has the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. Its IUPAC name is 6-chloro-1-cyclopentyl-4,7-dihydropyrazolo[5,4-d]pyrimidine.
| Compound Name | 6-chloro-1-cyclopentyl-4,7-dihydropyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 136921557 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 6-chloro-1-cyclopentyl-4,7-dihydropyrazolo[5,4-d]pyrimidine |
| SMILES | ClC1=NCc2cnn(C3CCCC3)c2N1 |
| InChI | InChI=1S/C10H13ClN4/c11-10-12-5-7-6-13-15(9(7)14-10)8-3-1-2-4-8/h6,8H,1-5H2,(H,12,14) |
| InChIKey | NTHDWADOVZRSFB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|