C17H19N3O2S — CID 136921656
2-[[N-(2-hydroxybutyl)anilino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136921656) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 2-[[N-(2-hydroxybutyl)anilino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[N-(2-hydroxybutyl)anilino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136921656 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-[[N-(2-hydroxybutyl)anilino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCC(O)CN(Cc1nc2ccsc2c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O2S/c1-2-13(21)10-20(12-6-4-3-5-7-12)11-15-18-14-8-9-23-16(14)17(22)19-15/h3-9,13,21H,2,10-11H2,1H3,(H,18,19,22) |
| InChIKey | FTTFRCGAAUESDF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |