C11H15N3O2S — CID 136969537
2-[(2-hydroxybutylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136969537) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-[(2-hydroxybutylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(2-hydroxybutylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136969537 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-[(2-hydroxybutylamino)methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCC(O)CNCc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N3O2S/c1-2-7(15)5-12-6-9-13-8-3-4-17-10(8)11(16)14-9/h3-4,7,12,15H,2,5-6H2,1H3,(H,13,14,16) |
| InChIKey | YUAJOSJKTARVBG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |