C14H22N4OS — CID 136870191
2-[[2-[butan-2-yl(methyl)amino]ethylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136870191) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[[2-[butan-2-yl(methyl)amino]ethylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[2-[butan-2-yl(methyl)amino]ethylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136870191 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-[[2-[butan-2-yl(methyl)amino]ethylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCC(C)N(C)CCNCc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H22N4OS/c1-4-10(2)18(3)7-6-15-9-12-16-11-5-8-20-13(11)14(19)17-12/h5,8,10,15H,4,6-7,9H2,1-3H3,(H,16,17,19) |
| InChIKey | QCVGUFYSQISGDN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|