C10H10F3N3OS2 — CID 136842313
2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136842313) has the molecular formula C10H10F3N3OS2 and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136842313 |
| Molecular Formula | C10H10F3N3OS2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CNCCSC(F)(F)F)nc2ccsc12 |
| InChI | InChI=1S/C10H10F3N3OS2/c11-10(12,13)19-4-2-14-5-7-15-6-1-3-18-8(6)9(17)16-7/h1,3,14H,2,4-5H2,(H,15,16,17) |
| InChIKey | UCLODONHOCCEHT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|