About 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one
2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one (PubChem CID 136923897) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one.
Analyze 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one?
The IUPAC name of 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one (CID 136923897) is 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one.
What is the SMILES notation for 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one?
The canonical SMILES for 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one is O=c1c2c(nc3n1CCCN3)CCCCC2.
What is the InChIKey of 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one?
The InChIKey is YTFOXVQPACBIJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c16-11-9-5-2-1-3-6-10(9)14-12-13-7-4-8-15(11)12/h1-8H2,(H,13,14).
What are the key properties of 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one?
2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one has a molecular weight of 219.29 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,8-triazatricyclo[8.5.0.03,8]pentadeca-1(10),2-dien-9-one is sourced from PubChem (CID 136923897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).