C12H13N3O — CID 136826742
8-methyl-1,2,3,4-tetrahydropyrimido[2,1-b]quinazolin-6-one (PubChem CID 136826742) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 8-methyl-1,2,3,4-tetrahydropyrimido[2,1-b]quinazolin-6-one.
| Compound Name | 8-methyl-1,2,3,4-tetrahydropyrimido[2,1-b]quinazolin-6-one |
|---|---|
| PubChem CID | 136826742 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 8-methyl-1,2,3,4-tetrahydropyrimido[2,1-b]quinazolin-6-one |
| SMILES | Cc1ccc2nc3n(c(=O)c2c1)CCCN3 |
| InChI | InChI=1S/C12H13N3O/c1-8-3-4-10-9(7-8)11(16)15-6-2-5-13-12(15)14-10/h3-4,7H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | IWGBZWIKYWOVJZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |