C13H12BrFN4O2 — CID 136924911
3-(4-bromo-2-fluorophenoxy)-N'-hydroxy-5,6-dimethylpyridazine-4-carboximidamide (PubChem CID 136924911) has the molecular formula C13H12BrFN4O2 and a molecular weight of 355.17 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenoxy)-N'-hydroxy-5,6-dimethylpyridazine-4-carboximidamide.
| Compound Name | 3-(4-bromo-2-fluorophenoxy)-N'-hydroxy-5,6-dimethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 136924911 |
| Molecular Formula | C13H12BrFN4O2 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 3-(4-bromo-2-fluorophenoxy)-N'-hydroxy-5,6-dimethylpyridazine-4-carboximidamide |
| SMILES | Cc1nnc(Oc2ccc(Br)cc2F)c(/C(N)=N/O)c1C |
| InChI | InChI=1S/C13H12BrFN4O2/c1-6-7(2)17-18-13(11(6)12(16)19-20)21-10-4-3-8(14)5-9(10)15/h3-5,20H,1-2H3,(H2,16,19) |
| InChIKey | XKOROCQYDNIDKX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|