C14H15N5O2 — CID 136925362
2-[3-amino-5-(2-methoxyethyl)-1H-pyrazol-4-yl]-3H-quinazolin-4-one (PubChem CID 136925362) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-[3-amino-5-(2-methoxyethyl)-1H-pyrazol-4-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[3-amino-5-(2-methoxyethyl)-1H-pyrazol-4-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136925362 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-[3-amino-5-(2-methoxyethyl)-1H-pyrazol-4-yl]-3H-quinazolin-4-one |
| SMILES | COCCc1[nH]nc(N)c1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H15N5O2/c1-21-7-6-10-11(12(15)19-18-10)13-16-9-5-3-2-4-8(9)14(20)17-13/h2-5H,6-7H2,1H3,(H3,15,18,19)(H,16,17,20) |
| InChIKey | ODLSLJWHQQPVND-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |