C14H15N3O4 — CID 135401356
2-methoxyethyl N-[(Z)-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]carbamate (PubChem CID 135401356) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-methoxyethyl N-[(Z)-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[(Z)-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]carbamate |
|---|---|
| PubChem CID | 135401356 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-methoxyethyl N-[(Z)-2-(4-oxo-3H-quinazolin-2-yl)ethenyl]carbamate |
| SMILES | COCCOC(=O)N/C=C\c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H15N3O4/c1-20-8-9-21-14(19)15-7-6-12-16-11-5-3-2-4-10(11)13(18)17-12/h2-7H,8-9H2,1H3,(H,15,19)(H,16,17,18)/b7-6- |
| InChIKey | BDXDWXGIWSTJJN-SREVYHEPSA-N |
| XLogP | 1.27 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|