C15H21N3O2 — CID 137273780
2-[(4-methoxy-2,2-dimethylbutyl)amino]-3H-quinazolin-4-one (PubChem CID 137273780) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[(4-methoxy-2,2-dimethylbutyl)amino]-3H-quinazolin-4-one.
| Compound Name | 2-[(4-methoxy-2,2-dimethylbutyl)amino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137273780 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-[(4-methoxy-2,2-dimethylbutyl)amino]-3H-quinazolin-4-one |
| SMILES | COCCC(C)(C)CNc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H21N3O2/c1-15(2,8-9-20-3)10-16-14-17-12-7-5-4-6-11(12)13(19)18-14/h4-7H,8-10H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | YVHIHTCUBBAMMT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |