C19H20N4O2 — CID 137264386
N-benzyl-N-ethyl-2-[(4-oxo-3H-quinazolin-2-yl)amino]acetamide (PubChem CID 137264386) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[(4-oxo-3H-quinazolin-2-yl)amino]acetamide.
| Compound Name | N-benzyl-N-ethyl-2-[(4-oxo-3H-quinazolin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 137264386 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-benzyl-N-ethyl-2-[(4-oxo-3H-quinazolin-2-yl)amino]acetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CNc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H20N4O2/c1-2-23(13-14-8-4-3-5-9-14)17(24)12-20-19-21-16-11-7-6-10-15(16)18(25)22-19/h3-11H,2,12-13H2,1H3,(H2,20,21,22,25) |
| InChIKey | VZVJKPNXMYJWFY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |