C18H18ClN3O2 — CID 137264955
2-[[1-(4-chlorophenyl)-3-methoxypropyl]amino]-3H-quinazolin-4-one (PubChem CID 137264955) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)-3-methoxypropyl]amino]-3H-quinazolin-4-one.
| Compound Name | 2-[[1-(4-chlorophenyl)-3-methoxypropyl]amino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137264955 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)-3-methoxypropyl]amino]-3H-quinazolin-4-one |
| SMILES | COCCC(Nc1nc2ccccc2c(=O)[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O2/c1-24-11-10-15(12-6-8-13(19)9-7-12)20-18-21-16-5-3-2-4-14(16)17(23)22-18/h2-9,15H,10-11H2,1H3,(H2,20,21,22,23) |
| InChIKey | PRRCOTMBPZCTMJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |