C23H26ClN7O2 — CID 136931405
1-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]-3-[5-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]urea (PubChem CID 136931405) has the molecular formula C23H26ClN7O2 and a molecular weight of 467.96 g/mol. Its IUPAC name is 1-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]-3-[5-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]urea.
| Compound Name | 1-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]-3-[5-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 136931405 |
| Molecular Formula | C23H26ClN7O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 1-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]-3-[5-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]urea |
| SMILES | C=C/C(=C\C=C(/C)Cl)NC(=O)Nc1cn[nH]c1-c1nc2ccc(CN3CCOCC3)cc2[nH]1 |
| InChI | InChI=1S/C23H26ClN7O2/c1-3-17(6-4-15(2)24)26-23(32)29-20-13-25-30-21(20)22-27-18-7-5-16(12-19(18)28-22)14-31-8-10-33-11-9-31/h3-7,12-13H,1,8-11,14H2,2H3,(H,25,30)(H,27,28)(H2,26,29,32)/b15-4+,17-6+ |
| InChIKey | BWGFYEYLHNMPEX-PGNDCSMCSA-N |
| XLogP | 4.12 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|