C23H30N10OS — CID 141451266
1-N'-tert-butyl-2-N-[5-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]-1-N-(1,3,4-thiadiazol-2-yl)ethene-1,1,2-triamine (PubChem CID 141451266) has the molecular formula C23H30N10OS and a molecular weight of 494.63 g/mol. Its IUPAC name is 1-N'-tert-butyl-2-N-[5-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]-1-N-(1,3,4-thiadiazol-2-yl)ethene-1,1,2-triamine.
| Compound Name | 1-N'-tert-butyl-2-N-[5-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]-1-N-(1,3,4-thiadiazol-2-yl)ethene-1,1,2-triamine |
|---|---|
| PubChem CID | 141451266 |
| Molecular Formula | C23H30N10OS |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1-N'-tert-butyl-2-N-[5-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]-1-N-(1,3,4-thiadiazol-2-yl)ethene-1,1,2-triamine |
| SMILES | CC(C)(C)NC(=CNc1cn[nH]c1-c1nc2ccc(CN3CCOCC3)cc2[nH]1)Nc1nncs1 |
| InChI | InChI=1S/C23H30N10OS/c1-23(2,3)30-19(29-22-32-26-14-35-22)12-24-18-11-25-31-20(18)21-27-16-5-4-15(10-17(16)28-21)13-33-6-8-34-9-7-33/h4-5,10-12,14,24,30H,6-9,13H2,1-3H3,(H,25,31)(H,27,28)(H,29,32) |
| InChIKey | CJVLUJCDUJKMIG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |