C11H13N5O2 — CID 136932336
6-(1-ethylpyrazol-4-yl)oxy-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136932336) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 6-(1-ethylpyrazol-4-yl)oxy-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 6-(1-ethylpyrazol-4-yl)oxy-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136932336 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6-(1-ethylpyrazol-4-yl)oxy-N'-hydroxypyridine-2-carboximidamide |
| SMILES | CCn1cc(Oc2cccc(/C(N)=N/O)n2)cn1 |
| InChI | InChI=1S/C11H13N5O2/c1-2-16-7-8(6-13-16)18-10-5-3-4-9(14-10)11(12)15-17/h3-7,17H,2H2,1H3,(H2,12,15) |
| InChIKey | NOZCWXRCRHFMFN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|