C14H14N4O3 — CID 170637109
6-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 170637109) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 6-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 170637109 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 6-[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cccc(Oc2ccc(/C(N)=N/O)cc2)n1 |
| InChI | InChI=1S/C14H14N4O3/c1-16-14(19)11-3-2-4-12(17-11)21-10-7-5-9(6-8-10)13(15)18-20/h2-8,20H,1H3,(H2,15,18)(H,16,19) |
| InChIKey | ODEIQSLNCRMDSS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|