C13H19ClIN3O — CID 136933994
4-[2-(2-chloropropyl)azepan-1-yl]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136933994) has the molecular formula C13H19ClIN3O and a molecular weight of 395.67 g/mol. Its IUPAC name is 4-[2-(2-chloropropyl)azepan-1-yl]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(2-chloropropyl)azepan-1-yl]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136933994 |
| Molecular Formula | C13H19ClIN3O |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 4-[2-(2-chloropropyl)azepan-1-yl]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(Cl)CC1CCCCCN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C13H19ClIN3O/c1-9(14)7-10-5-3-2-4-6-18(10)12-11(15)13(19)17-8-16-12/h8-10H,2-7H2,1H3,(H,16,17,19) |
| InChIKey | JFERARKJZRXMIM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|