C11H15ClIN3O — CID 136859491
4-[(2-chlorocyclohexyl)-methylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136859491) has the molecular formula C11H15ClIN3O and a molecular weight of 367.62 g/mol. Its IUPAC name is 4-[(2-chlorocyclohexyl)-methylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-chlorocyclohexyl)-methylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136859491 |
| Molecular Formula | C11H15ClIN3O |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 4-[(2-chlorocyclohexyl)-methylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CN(c1nc[nH]c(=O)c1I)C1CCCCC1Cl |
| InChI | InChI=1S/C11H15ClIN3O/c1-16(8-5-3-2-4-7(8)12)10-9(13)11(17)15-6-14-10/h6-8H,2-5H2,1H3,(H,14,15,17) |
| InChIKey | PPXNWLKEEXIVOQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|