C10H13Cl2N3O — CID 136971786
5-chloro-4-[2-(chloromethyl)piperidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136971786) has the molecular formula C10H13Cl2N3O and a molecular weight of 262.14 g/mol. Its IUPAC name is 5-chloro-4-[2-(chloromethyl)piperidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[2-(chloromethyl)piperidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971786 |
| Molecular Formula | C10H13Cl2N3O |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 5-chloro-4-[2-(chloromethyl)piperidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCCCC2CCl)c1Cl |
| InChI | InChI=1S/C10H13Cl2N3O/c11-5-7-3-1-2-4-15(7)9-8(12)10(16)14-6-13-9/h6-7H,1-5H2,(H,13,14,16) |
| InChIKey | MVRCPTORUFWNGA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|