C12H19N5S2 — CID 136935142
3-(4-tert-butylthiadiazol-5-yl)-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 136935142) has the molecular formula C12H19N5S2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 3-(4-tert-butylthiadiazol-5-yl)-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-tert-butylthiadiazol-5-yl)-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136935142 |
| Molecular Formula | C12H19N5S2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-(4-tert-butylthiadiazol-5-yl)-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)Cn1c(-c2snnc2C(C)(C)C)n[nH]c1=S |
| InChI | InChI=1S/C12H19N5S2/c1-7(2)6-17-10(14-15-11(17)18)8-9(12(3,4)5)13-16-19-8/h7H,6H2,1-5H3,(H,15,18) |
| InChIKey | PGTFXHCOFWOBAS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|