C8H11N5S2 — CID 136935144
4-(2-methylpropyl)-3-(thiadiazol-5-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 136935144) has the molecular formula C8H11N5S2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-(2-methylpropyl)-3-(thiadiazol-5-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methylpropyl)-3-(thiadiazol-5-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136935144 |
| Molecular Formula | C8H11N5S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-(2-methylpropyl)-3-(thiadiazol-5-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)Cn1c(-c2cnns2)n[nH]c1=S |
| InChI | InChI=1S/C8H11N5S2/c1-5(2)4-13-7(10-11-8(13)14)6-3-9-12-15-6/h3,5H,4H2,1-2H3,(H,11,14) |
| InChIKey | DPCYHXLWIUTFAI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|