C14H15N3O — CID 136938634
4-[4-[(cyclopropylamino)methyl]pyrimidin-2-yl]phenol (PubChem CID 136938634) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[4-[(cyclopropylamino)methyl]pyrimidin-2-yl]phenol.
| Compound Name | 4-[4-[(cyclopropylamino)methyl]pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 136938634 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-[4-[(cyclopropylamino)methyl]pyrimidin-2-yl]phenol |
| SMILES | Oc1ccc(-c2nccc(CNC3CC3)n2)cc1 |
| InChI | InChI=1S/C14H15N3O/c18-13-5-1-10(2-6-13)14-15-8-7-12(17-14)9-16-11-3-4-11/h1-2,5-8,11,16,18H,3-4,9H2 |
| InChIKey | NNABKXCFSSYEBG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |