C10H12F3N3 — CID 141342009
N-[[2-(trifluoromethyl)pyrimidin-4-yl]methyl]cyclobutanamine (PubChem CID 141342009) has the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. Its IUPAC name is N-[[2-(trifluoromethyl)pyrimidin-4-yl]methyl]cyclobutanamine.
| Compound Name | N-[[2-(trifluoromethyl)pyrimidin-4-yl]methyl]cyclobutanamine |
|---|---|
| PubChem CID | 141342009 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-[[2-(trifluoromethyl)pyrimidin-4-yl]methyl]cyclobutanamine |
| SMILES | FC(F)(F)c1nccc(CNC2CCC2)n1 |
| InChI | InChI=1S/C10H12F3N3/c11-10(12,13)9-14-5-4-8(16-9)6-15-7-2-1-3-7/h4-5,7,15H,1-3,6H2 |
| InChIKey | WNUKLMAACKOACY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |