C13H18F3N3 — CID 62748227
N-[(2-methylpyrimidin-4-yl)methyl]-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 62748227) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-[(2-methylpyrimidin-4-yl)methyl]-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[(2-methylpyrimidin-4-yl)methyl]-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 62748227 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[(2-methylpyrimidin-4-yl)methyl]-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | Cc1nccc(CNC2CCC(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C13H18F3N3/c1-9-17-7-6-12(19-9)8-18-11-4-2-10(3-5-11)13(14,15)16/h6-7,10-11,18H,2-5,8H2,1H3 |
| InChIKey | RGHVTGUQVSOSEJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |