C20H17BrN4O2S — CID 136940536
6-(2-bromo-5-methoxyphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 136940536) has the molecular formula C20H17BrN4O2S and a molecular weight of 457.35 g/mol. Its IUPAC name is 6-(2-bromo-5-methoxyphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 6-(2-bromo-5-methoxyphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 136940536 |
| Molecular Formula | C20H17BrN4O2S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 6-(2-bromo-5-methoxyphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2C(=c3ccccc3=NC2c2cc(OC)ccc2Br)C(=O)N1 |
| InChI | InChI=1S/C20H17BrN4O2S/c1-3-10-28-20-23-19(26)17-13-6-4-5-7-16(13)22-18(25(17)24-20)14-11-12(27-2)8-9-15(14)21/h3-9,11,18H,1,10H2,2H3,(H,23,24,26) |
| InChIKey | QIOHKBQZLFLDGJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|