C21H22N4O3S — CID 137236393
(6R)-6-(2,4-dimethoxyphenyl)-3-propylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236393) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is (6R)-6-(2,4-dimethoxyphenyl)-3-propylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-6-(2,4-dimethoxyphenyl)-3-propylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236393 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (6R)-6-(2,4-dimethoxyphenyl)-3-propylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCSC1=NN2C(=c3ccccc3=N[C@H]2c2ccc(OC)cc2OC)C(=O)N1 |
| InChI | InChI=1S/C21H22N4O3S/c1-4-11-29-21-23-20(26)18-14-7-5-6-8-16(14)22-19(25(18)24-21)15-10-9-13(27-2)12-17(15)28-3/h5-10,12,19H,4,11H2,1-3H3,(H,23,24,26)/t19-/m1/s1 |
| InChIKey | LXKOSADAQHRKEQ-LJQANCHMSA-N |
| XLogP | 1.99 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |