C21H21BrN4O2S — CID 137237310
(6R)-6-(5-bromo-2-methoxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237310) has the molecular formula C21H21BrN4O2S and a molecular weight of 473.40 g/mol. Its IUPAC name is (6R)-6-(5-bromo-2-methoxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-6-(5-bromo-2-methoxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237310 |
| Molecular Formula | C21H21BrN4O2S |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | (6R)-6-(5-bromo-2-methoxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3ccccc3=N[C@H]2c2cc(Br)ccc2OC)C(=O)N1 |
| InChI | InChI=1S/C21H21BrN4O2S/c1-3-4-11-29-21-24-20(27)18-14-7-5-6-8-16(14)23-19(26(18)25-21)15-12-13(22)9-10-17(15)28-2/h5-10,12,19H,3-4,11H2,1-2H3,(H,24,25,27)/t19-/m1/s1 |
| InChIKey | NOPFNBMQVCBAGQ-LJQANCHMSA-N |
| XLogP | 3.13 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|