C25H29BrN4O2S — CID 137236592
(6S)-10-bromo-3-butylsulfanyl-6-(2-pentoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236592) has the molecular formula C25H29BrN4O2S and a molecular weight of 529.50 g/mol. Its IUPAC name is (6S)-10-bromo-3-butylsulfanyl-6-(2-pentoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-10-bromo-3-butylsulfanyl-6-(2-pentoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236592 |
| Molecular Formula | C25H29BrN4O2S |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | (6S)-10-bromo-3-butylsulfanyl-6-(2-pentoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCOc1ccccc1[C@H]1N=c2ccc(Br)cc2=C2C(=O)NC(SCCCC)=NN21 |
| InChI | InChI=1S/C25H29BrN4O2S/c1-3-5-9-14-32-21-11-8-7-10-18(21)23-27-20-13-12-17(26)16-19(20)22-24(31)28-25(29-30(22)23)33-15-6-4-2/h7-8,10-13,16,23H,3-6,9,14-15H2,1-2H3,(H,28,29,31)/t23-/m0/s1 |
| InChIKey | VCPNLRNTZSQSET-QHCPKHFHSA-N |
| XLogP | 4.69 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|