C21H22BrN5OS — CID 137236809
(6S)-10-bromo-3-hexylsulfanyl-6-pyridin-4-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236809) has the molecular formula C21H22BrN5OS and a molecular weight of 472.41 g/mol. Its IUPAC name is (6S)-10-bromo-3-hexylsulfanyl-6-pyridin-4-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-10-bromo-3-hexylsulfanyl-6-pyridin-4-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236809 |
| Molecular Formula | C21H22BrN5OS |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | (6S)-10-bromo-3-hexylsulfanyl-6-pyridin-4-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCSC1=NN2C(=c3cc(Br)ccc3=N[C@@H]2c2ccncc2)C(=O)N1 |
| InChI | InChI=1S/C21H22BrN5OS/c1-2-3-4-5-12-29-21-25-20(28)18-16-13-15(22)6-7-17(16)24-19(27(18)26-21)14-8-10-23-11-9-14/h6-11,13,19H,2-5,12H2,1H3,(H,25,26,28)/t19-/m0/s1 |
| InChIKey | KRJMMVWZPNIZOS-IBGZPJMESA-N |
| XLogP | 3.30 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|