C13H24N2S — CID 136948856
N-(2,2-dimethylcyclopentyl)-4,5-dimethyl-1,3-thiazinan-2-imine (PubChem CID 136948856) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopentyl)-4,5-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-(2,2-dimethylcyclopentyl)-4,5-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136948856 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N-(2,2-dimethylcyclopentyl)-4,5-dimethyl-1,3-thiazinan-2-imine |
| SMILES | CC1CS/C(=N\C2CCCC2(C)C)NC1C |
| InChI | InChI=1S/C13H24N2S/c1-9-8-16-12(14-10(9)2)15-11-6-5-7-13(11,3)4/h9-11H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | QDTRYCNNWUIMDW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|