C14H22N2S2 — CID 136948866
4,5-dimethyl-N-(2-methyl-2-thiophen-2-ylpropyl)-1,3-thiazinan-2-imine (PubChem CID 136948866) has the molecular formula C14H22N2S2 and a molecular weight of 282.48 g/mol. Its IUPAC name is 4,5-dimethyl-N-(2-methyl-2-thiophen-2-ylpropyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,5-dimethyl-N-(2-methyl-2-thiophen-2-ylpropyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136948866 |
| Molecular Formula | C14H22N2S2 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4,5-dimethyl-N-(2-methyl-2-thiophen-2-ylpropyl)-1,3-thiazinan-2-imine |
| SMILES | CC1CS/C(=N\CC(C)(C)c2cccs2)NC1C |
| InChI | InChI=1S/C14H22N2S2/c1-10-8-18-13(16-11(10)2)15-9-14(3,4)12-6-5-7-17-12/h5-7,10-11H,8-9H2,1-4H3,(H,15,16) |
| InChIKey | YWVMZRNDICKDEQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|