C18H20ClFN8O3 — CID 136950021
5-N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-(3-chloro-4-fluorophenyl)-3-N-diazenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide (PubChem CID 136950021) has the molecular formula C18H20ClFN8O3 and a molecular weight of 450.86 g/mol. Its IUPAC name is 5-N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-(3-chloro-4-fluorophenyl)-3-N-diazenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide.
| Compound Name | 5-N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-(3-chloro-4-fluorophenyl)-3-N-diazenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 136950021 |
| Molecular Formula | C18H20ClFN8O3 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 5-N-(1-amino-2-methyl-1-oxopropan-2-yl)-2-(3-chloro-4-fluorophenyl)-3-N-diazenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
| SMILES | [H]/N=N/NC(=O)c1c(-c2ccc(F)c(Cl)c2)nn2c1CN(C(=O)NC(C)(C)C(N)=O)CC2 |
| InChI | InChI=1S/C18H20ClFN8O3/c1-18(2,16(21)30)23-17(31)27-5-6-28-12(8-27)13(15(29)24-26-22)14(25-28)9-3-4-11(20)10(19)7-9/h3-4,7H,5-6,8H2,1-2H3,(H2,21,30)(H,23,31)(H2,22,24,29) |
| InChIKey | NZNUHZSUCRTGSW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 158.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|