C21H21Cl2F2N7O2 — CID 136950015
3-N-diazenyl-2-(3,4-dichlorophenyl)-5-N-(2,2-difluoro-5-methylspiro[2.3]hexan-5-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide (PubChem CID 136950015) has the molecular formula C21H21Cl2F2N7O2 and a molecular weight of 512.35 g/mol. Its IUPAC name is 3-N-diazenyl-2-(3,4-dichlorophenyl)-5-N-(2,2-difluoro-5-methylspiro[2.3]hexan-5-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide.
| Compound Name | 3-N-diazenyl-2-(3,4-dichlorophenyl)-5-N-(2,2-difluoro-5-methylspiro[2.3]hexan-5-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 136950015 |
| Molecular Formula | C21H21Cl2F2N7O2 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 3-N-diazenyl-2-(3,4-dichlorophenyl)-5-N-(2,2-difluoro-5-methylspiro[2.3]hexan-5-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
| SMILES | [H]/N=N/NC(=O)c1c(-c2ccc(Cl)c(Cl)c2)nn2c1CN(C(=O)NC1(C)CC3(C1)CC3(F)F)CC2 |
| InChI | InChI=1S/C21H21Cl2F2N7O2/c1-19(8-20(9-19)10-21(20,24)25)27-18(34)31-4-5-32-14(7-31)15(17(33)28-30-26)16(29-32)11-2-3-12(22)13(23)6-11/h2-3,6H,4-5,7-10H2,1H3,(H,27,34)(H2,26,28,33) |
| InChIKey | JGCRJDGEVBUSOI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|