C22H27ClN6O3 — CID 136949995
tert-butyl 2-(3-chloro-4-ethylphenyl)-3-(diazenylcarbamoyl)spiro[4,7-dihydropyrazolo[1,5-a]pyrazine-6,1'-cyclopropane]-5-carboxylate (PubChem CID 136949995) has the molecular formula C22H27ClN6O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is tert-butyl 2-(3-chloro-4-ethylphenyl)-3-(diazenylcarbamoyl)spiro[4,7-dihydropyrazolo[1,5-a]pyrazine-6,1'-cyclopropane]-5-carboxylate.
| Compound Name | tert-butyl 2-(3-chloro-4-ethylphenyl)-3-(diazenylcarbamoyl)spiro[4,7-dihydropyrazolo[1,5-a]pyrazine-6,1'-cyclopropane]-5-carboxylate |
|---|---|
| PubChem CID | 136949995 |
| Molecular Formula | C22H27ClN6O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | tert-butyl 2-(3-chloro-4-ethylphenyl)-3-(diazenylcarbamoyl)spiro[4,7-dihydropyrazolo[1,5-a]pyrazine-6,1'-cyclopropane]-5-carboxylate |
| SMILES | [H]/N=N/NC(=O)c1c(-c2ccc(CC)c(Cl)c2)nn2c1CN(C(=O)OC(C)(C)C)C1(CC1)C2 |
| InChI | InChI=1S/C22H27ClN6O3/c1-5-13-6-7-14(10-15(13)23)18-17(19(30)25-27-24)16-11-28(20(31)32-21(2,3)4)22(8-9-22)12-29(16)26-18/h6-7,10H,5,8-9,11-12H2,1-4H3,(H2,24,25,30) |
| InChIKey | DSCVGDYMWOJALQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 112.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|