C24H27FN6S — CID 136950071
(Z)-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-(2-piperidin-1-yl-1,3-thiazol-4-yl)-1H-imidazol-2-yl]prop-2-en-1-imine (PubChem CID 136950071) has the molecular formula C24H27FN6S and a molecular weight of 450.59 g/mol. Its IUPAC name is (Z)-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-(2-piperidin-1-yl-1,3-thiazol-4-yl)-1H-imidazol-2-yl]prop-2-en-1-imine.
| Compound Name | (Z)-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-(2-piperidin-1-yl-1,3-thiazol-4-yl)-1H-imidazol-2-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 136950071 |
| Molecular Formula | C24H27FN6S |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (Z)-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-[5-(2-piperidin-1-yl-1,3-thiazol-4-yl)-1H-imidazol-2-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C\c1ncc(-c2csc(N3CCCCC3)n2)[nH]1)N1CCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C24H27FN6S/c25-18-7-4-6-17(14-18)21-8-5-13-31(21)22(26)9-10-23-27-15-19(28-23)20-16-32-24(29-20)30-11-2-1-3-12-30/h4,6-7,9-10,14-16,21,26H,1-3,5,8,11-13H2,(H,27,28)/b10-9-,26-22- |
| InChIKey | WNZPOPLXNCJREW-TXVBKZQUSA-N |
| XLogP | 5.49 |
| TPSA | 71.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|