C27H30F3N5O5 — CID 136950567
ethyl 3-[4-[[1-[(3S)-3-(cyanomethyl)oxan-3-yl]-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]phenyl]-4,4,4-trifluoro-3-hydroxy-2,2-dimethylbutanoate (PubChem CID 136950567) has the molecular formula C27H30F3N5O5 and a molecular weight of 561.56 g/mol. Its IUPAC name is ethyl 3-[4-[[1-[(3S)-3-(cyanomethyl)oxan-3-yl]-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]phenyl]-4,4,4-trifluoro-3-hydroxy-2,2-dimethylbutanoate.
| Compound Name | ethyl 3-[4-[[1-[(3S)-3-(cyanomethyl)oxan-3-yl]-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]phenyl]-4,4,4-trifluoro-3-hydroxy-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 136950567 |
| Molecular Formula | C27H30F3N5O5 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | ethyl 3-[4-[[1-[(3S)-3-(cyanomethyl)oxan-3-yl]-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]phenyl]-4,4,4-trifluoro-3-hydroxy-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(O)(c1ccc(Nc2nn([C@]3(CC#N)CCCOC3)c3cc[nH]c(=O)c23)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H30F3N5O5/c1-4-40-23(37)24(2,3)26(38,27(28,29)30)17-6-8-18(9-7-17)33-21-20-19(10-14-32-22(20)36)35(34-21)25(12-13-31)11-5-15-39-16-25/h6-10,14,38H,4-5,11-12,15-16H2,1-3H3,(H,32,36)(H,33,34)/t25-,26?/m0/s1 |
| InChIKey | VJVORXZALOVSQP-PMCHYTPCSA-N |
| XLogP | 4.23 |
| TPSA | 142.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |