C27H30F3N5O4 — CID 136950756
ethyl 3-[4-[[1-[(1S,2S)-2-cyanocyclohexyl]-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]phenyl]-4,4,4-trifluoro-3-hydroxy-2,2-dimethylbutanoate (PubChem CID 136950756) has the molecular formula C27H30F3N5O4 and a molecular weight of 545.56 g/mol. Its IUPAC name is ethyl 3-[4-[[1-[(1S,2S)-2-cyanocyclohexyl]-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]phenyl]-4,4,4-trifluoro-3-hydroxy-2,2-dimethylbutanoate.
| Compound Name | ethyl 3-[4-[[1-[(1S,2S)-2-cyanocyclohexyl]-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]phenyl]-4,4,4-trifluoro-3-hydroxy-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 136950756 |
| Molecular Formula | C27H30F3N5O4 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | ethyl 3-[4-[[1-[(1S,2S)-2-cyanocyclohexyl]-4-oxo-5H-pyrazolo[4,3-c]pyridin-3-yl]amino]phenyl]-4,4,4-trifluoro-3-hydroxy-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(O)(c1ccc(Nc2nn([C@H]3CCCC[C@@H]3C#N)c3cc[nH]c(=O)c23)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H30F3N5O4/c1-4-39-24(37)25(2,3)26(38,27(28,29)30)17-9-11-18(12-10-17)33-22-21-20(13-14-32-23(21)36)35(34-22)19-8-6-5-7-16(19)15-31/h9-14,16,19,38H,4-8H2,1-3H3,(H,32,36)(H,33,34)/t16-,19+,26?/m1/s1 |
| InChIKey | ZKNJDSWDGNMUQM-QGGXTUAISA-N |
| XLogP | 5.06 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |