C27H27FN5O7P — CID 136953708
2-amino-9-[2-[[(3-fluoro-4-methylphenyl)methoxy-[(2-methylidene-5-phenyl-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953708) has the molecular formula C27H27FN5O7P and a molecular weight of 583.51 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-fluoro-4-methylphenyl)methoxy-[(2-methylidene-5-phenyl-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-fluoro-4-methylphenyl)methoxy-[(2-methylidene-5-phenyl-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953708 |
| Molecular Formula | C27H27FN5O7P |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 2-amino-9-[2-[[(3-fluoro-4-methylphenyl)methoxy-[(2-methylidene-5-phenyl-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | C=C1OC(COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2ccc(C)c(F)c2)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C27H27FN5O7P/c1-17-8-9-19(12-21(17)28)13-37-41(35,38-14-22-24(40-18(2)39-22)20-6-4-3-5-7-20)16-36-11-10-33-15-30-23-25(33)31-27(29)32-26(23)34/h3-9,12,15H,2,10-11,13-14,16H2,1H3,(H3,29,31,32,34) |
| InChIKey | SASHSMXSZKVUBD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|