C11H15IN4O2 — CID 136954300
1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 136954300) has the molecular formula C11H15IN4O2 and a molecular weight of 362.17 g/mol. Its IUPAC name is 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 136954300 |
| Molecular Formula | C11H15IN4O2 |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H15IN4O2/c1-15(2)11(18)7-4-3-5-16(7)9-8(12)10(17)14-6-13-9/h6-7H,3-5H2,1-2H3,(H,13,14,17) |
| InChIKey | LSEHBPDVNNDKQI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|