C9H11IN4O2 — CID 136956537
5-iodo-4-[(2-oxopiperidin-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136956537) has the molecular formula C9H11IN4O2 and a molecular weight of 334.12 g/mol. Its IUPAC name is 5-iodo-4-[(2-oxopiperidin-3-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(2-oxopiperidin-3-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956537 |
| Molecular Formula | C9H11IN4O2 |
| Molecular Weight | 334.12 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 5-iodo-4-[(2-oxopiperidin-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | O=C1NCCCC1Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H11IN4O2/c10-6-7(12-4-13-9(6)16)14-5-2-1-3-11-8(5)15/h4-5H,1-3H2,(H,11,15)(H2,12,13,14,16) |
| InChIKey | FQPJZJGIVGXGGZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.12 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|