C11H19N3O3S — CID 136955107
2-(1-methylsulfonylethyl)-4-(propylaminomethyl)-1H-pyrimidin-6-one (PubChem CID 136955107) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(1-methylsulfonylethyl)-4-(propylaminomethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(1-methylsulfonylethyl)-4-(propylaminomethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136955107 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(1-methylsulfonylethyl)-4-(propylaminomethyl)-1H-pyrimidin-6-one |
| SMILES | CCCNCc1cc(=O)[nH]c(C(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H19N3O3S/c1-4-5-12-7-9-6-10(15)14-11(13-9)8(2)18(3,16)17/h6,8,12H,4-5,7H2,1-3H3,(H,13,14,15) |
| InChIKey | PPSJYSOTACVVJH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|