C9H14BrN3O — CID 136955956
5-bromo-4-(pentylamino)-1H-pyrimidin-6-one (PubChem CID 136955956) has the molecular formula C9H14BrN3O and a molecular weight of 260.13 g/mol. Its IUPAC name is 5-bromo-4-(pentylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(pentylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136955956 |
| Molecular Formula | C9H14BrN3O |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 5-bromo-4-(pentylamino)-1H-pyrimidin-6-one |
| SMILES | CCCCCNc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C9H14BrN3O/c1-2-3-4-5-11-8-7(10)9(14)13-6-12-8/h6H,2-5H2,1H3,(H2,11,12,13,14) |
| InChIKey | XXPKTUGSQVWNSD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|